C23H36O4 — CID 73347718
methyl (E,5R)-5-acetyloxy-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate (PubChem CID 73347718) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is methyl (E,5R)-5-acetyloxy-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate.
| Compound Name | methyl (E,5R)-5-acetyloxy-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 73347718 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | methyl (E,5R)-5-acetyloxy-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enoate |
| SMILES | COC(=O)/C=C(\C)C[C@@H](OC(C)=O)[C@@]1(C)[C@H](C)CC=C2[C@@H]1CCCC2(C)C |
| InChI | InChI=1S/C23H36O4/c1-15(14-21(25)26-7)13-20(27-17(3)24)23(6)16(2)10-11-18-19(23)9-8-12-22(18,4)5/h11,14,16,19-20H,8-10,12-13H2,1-7H3/b15-14+/t16-,19+,20-,23+/m1/s1 |
| InChIKey | MNGRESYUCPYXQL-GKPOZCKSSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|