C47H40ClN3O3 — CID 73347730
19-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione (PubChem CID 73347730) has the molecular formula C47H40ClN3O3 and a molecular weight of 730.31 g/mol. Its IUPAC name is 19-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione.
| Compound Name | 19-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
|---|---|
| PubChem CID | 73347730 |
| Molecular Formula | C47H40ClN3O3 |
| Molecular Weight | 730.31 g/mol |
| Exact Mass | 729.28 |
| IUPAC Name | 19-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-1,16-diphenyl-19-azahexacyclo[14.5.1.02,15.03,8.09,14.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20,22-trione |
| SMILES | O=C1C2C(C(=O)N1CCCCN1CCN(c3ccc(Cl)cc3)CC1)C1(c3ccccc3)C(=O)C2(c2ccccc2)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C47H40ClN3O3/c48-33-21-23-34(24-22-33)50-29-27-49(28-30-50)25-11-12-26-51-43(52)41-42(44(51)53)47(32-15-5-2-6-16-32)40-38-20-10-8-18-36(38)35-17-7-9-19-37(35)39(40)46(41,45(47)54)31-13-3-1-4-14-31/h1-10,13-24,41-42H,11-12,25-30H2 |
| InChIKey | VAWOSJDTOWTKRO-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.31 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|