C17H20Cl2O3 — CID 73347755
(2S,4aR,8R,8aR)-2-(3,4-dichlorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol (PubChem CID 73347755) has the molecular formula C17H20Cl2O3 and a molecular weight of 343.25 g/mol. Its IUPAC name is (2S,4aR,8R,8aR)-2-(3,4-dichlorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol.
| Compound Name | (2S,4aR,8R,8aR)-2-(3,4-dichlorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol |
|---|---|
| PubChem CID | 73347755 |
| Molecular Formula | C17H20Cl2O3 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (2S,4aR,8R,8aR)-2-(3,4-dichlorophenyl)-4,4,7-trimethyl-4a,5,8,8a-tetrahydro-1,3-benzodioxin-8-ol |
| SMILES | CC1=CC[C@@H]2[C@@H](O[C@H](c3ccc(Cl)c(Cl)c3)OC2(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H20Cl2O3/c1-9-4-6-11-15(14(9)20)21-16(22-17(11,2)3)10-5-7-12(18)13(19)8-10/h4-5,7-8,11,14-16,20H,6H2,1-3H3/t11-,14-,15-,16+/m1/s1 |
| InChIKey | JKAQTXYRWCPSQI-MPESAESLSA-N |
| XLogP | 4.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|