C18H17Cl2N — CID 73347777
(1S,3aR,9bS)-6,7-dichloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole (PubChem CID 73347777) has the molecular formula C18H17Cl2N and a molecular weight of 318.25 g/mol. Its IUPAC name is (1S,3aR,9bS)-6,7-dichloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole.
| Compound Name | (1S,3aR,9bS)-6,7-dichloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 73347777 |
| Molecular Formula | C18H17Cl2N |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (1S,3aR,9bS)-6,7-dichloro-1-phenyl-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indole |
| SMILES | Clc1ccc2c(c1Cl)CC[C@H]1NC[C@H](c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C18H17Cl2N/c19-15-8-6-12-13(18(15)20)7-9-16-17(12)14(10-21-16)11-4-2-1-3-5-11/h1-6,8,14,16-17,21H,7,9-10H2/t14-,16-,17-/m1/s1 |
| InChIKey | XWQSXOFSOWLMBI-DJIMGWMZSA-N |
| XLogP | 4.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |