C27H47NO8 — CID 73348161
[(2R,3R,6Z,8S,9R,10S,11Z)-3,9-dihydroxy-14-[(2S,3S,4S,5R)-4-(methoxymethoxy)-3,5-dimethyl-6-oxooxan-2-yl]-2,8,10-trimethyltetradeca-6,11-dienyl] carbamate (PubChem CID 73348161) has the molecular formula C27H47NO8 and a molecular weight of 513.67 g/mol. Its IUPAC name is [(2R,3R,6Z,8S,9R,10S,11Z)-3,9-dihydroxy-14-[(2S,3S,4S,5R)-4-(methoxymethoxy)-3,5-dimethyl-6-oxooxan-2-yl]-2,8,10-trimethyltetradeca-6,11-dienyl] carbamate.
| Compound Name | [(2R,3R,6Z,8S,9R,10S,11Z)-3,9-dihydroxy-14-[(2S,3S,4S,5R)-4-(methoxymethoxy)-3,5-dimethyl-6-oxooxan-2-yl]-2,8,10-trimethyltetradeca-6,11-dienyl] carbamate |
|---|---|
| PubChem CID | 73348161 |
| Molecular Formula | C27H47NO8 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | [(2R,3R,6Z,8S,9R,10S,11Z)-3,9-dihydroxy-14-[(2S,3S,4S,5R)-4-(methoxymethoxy)-3,5-dimethyl-6-oxooxan-2-yl]-2,8,10-trimethyltetradeca-6,11-dienyl] carbamate |
| SMILES | COCO[C@H]1[C@@H](C)[C@H](CC/C=C\[C@H](C)[C@H](O)[C@@H](C)/C=C\CC[C@@H](O)[C@H](C)COC(N)=O)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C27H47NO8/c1-17(11-7-9-13-22(29)19(3)15-34-27(28)32)24(30)18(2)12-8-10-14-23-20(4)25(35-16-33-6)21(5)26(31)36-23/h7-8,11-12,17-25,29-30H,9-10,13-16H2,1-6H3,(H2,28,32)/b11-7-,12-8-/t17-,18-,19+,20-,21+,22+,23-,24+,25-/m0/s1 |
| InChIKey | XKSHTJZNRZNUHY-IOPFDOBYSA-N |
| XLogP | 3.57 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|