C22H22N4O2 — CID 73348266
14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-10-amine (PubChem CID 73348266) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-10-amine.
| Compound Name | 14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-10-amine |
|---|---|
| PubChem CID | 73348266 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 14,19-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(24),2(27),3,5,8(26),9,11,16,21(25),22-decaen-10-amine |
| SMILES | Nc1cc2cc(c1)Nc1nccc(n1)-c1cccc(c1)COCC=CCOC2 |
| InChI | InChI=1S/C22H22N4O2/c23-19-11-17-12-20(13-19)25-22-24-7-6-21(26-22)18-5-3-4-16(10-18)14-27-8-1-2-9-28-15-17/h1-7,10-13H,8-9,14-15,23H2,(H,24,25,26) |
| InChIKey | LVRXBZNKAGNVHM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|