About [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine
[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine (PubChem CID 73348273) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine.
Molecular Properties
| Compound Name | [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine |
| PubChem CID | 73348273 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(C=NN)cn2C |
| InChI | InChI=1S/C21H23N3O3/c1-13(15-9-19(25-3)21(27-5)20(10-15)26-4)14-6-7-18-17(8-14)16(11-23-22)12-24(18)2/h6-12H,1,22H2,2-5H3 |
| InChIKey | USMZNJZTLDKPDK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine?
The IUPAC name of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine (CID 73348273) is [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine.
What is the SMILES notation for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine?
The canonical SMILES for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine is C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(C=NN)cn2C.
What is the InChIKey of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine?
The InChIKey is USMZNJZTLDKPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-13(15-9-19(25-3)21(27-5)20(10-15)26-4)14-6-7-18-17(8-14)16(11-23-22)12-24(18)2/h6-12H,1,22H2,2-5H3.
What are the key properties of [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine?
[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine has a molecular weight of 365.43 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidenehydrazine is sourced from PubChem (CID 73348273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).