C21H28O5S — CID 73348317
(1R,4S,5R,8S,9R,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane (PubChem CID 73348317) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane.
| Compound Name | (1R,4S,5R,8S,9R,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
|---|---|
| PubChem CID | 73348317 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (1R,4S,5R,8S,9R,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
| SMILES | C[C@@H]1[C@@H]2CC[C@@H](C)[C@@H]3CC[C@@]4(C)O[C@@H](O[C@@H]1S(=O)(=O)c1ccccc1)[C@]23O4 |
| InChI | InChI=1S/C21H28O5S/c1-13-9-10-17-14(2)18(27(22,23)15-7-5-4-6-8-15)24-19-21(17)16(13)11-12-20(3,25-19)26-21/h4-8,13-14,16-19H,9-12H2,1-3H3/t13-,14-,16+,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | NZBFBOGVWBAZHV-BLWYLUKMSA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |