About (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one
(4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one (PubChem CID 73348388) has the molecular formula C19H15F3O3
and a molecular weight of 348.32 g/mol. Its IUPAC name is (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one.
Molecular Properties
| Compound Name | (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one |
| PubChem CID | 73348388 |
| Molecular Formula | C19H15F3O3 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one |
| SMILES | O=C1C[C@H](O)C[C@@H](/C=C/c2c(F)cc(F)cc2-c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C19H15F3O3/c20-12-3-1-11(2-4-12)17-7-13(21)8-18(22)16(17)6-5-15-9-14(23)10-19(24)25-15/h1-8,14-15,23H,9-10H2/b6-5+/t14-,15-/m1/s1 |
| InChIKey | GCAHUKVKFOSJJQ-XEVLESSRSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one?
The IUPAC name of (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one (CID 73348388) is (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one.
What is the SMILES notation for (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one?
The canonical SMILES for (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one is O=C1C[C@H](O)C[C@@H](/C=C/c2c(F)cc(F)cc2-c2ccc(F)cc2)O1.
What is the InChIKey of (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one?
The InChIKey is GCAHUKVKFOSJJQ-XEVLESSRSA-N. The full InChI is InChI=1S/C19H15F3O3/c20-12-3-1-11(2-4-12)17-7-13(21)8-18(22)16(17)6-5-15-9-14(23)10-19(24)25-15/h1-8,14-15,23H,9-10H2/b6-5+/t14-,15-/m1/s1.
What are the key properties of (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one?
(4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one has a molecular weight of 348.32 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-6-[(E)-2-[2,4-difluoro-6-(4-fluorophenyl)phenyl]ethenyl]-4-hydroxyoxan-2-one is sourced from PubChem (CID 73348388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).