C19H14ClN3O3S — CID 73349028
6-[(4-chlorophenyl)methyl]spiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,3'-1H-indole]-2',5,7-trione (PubChem CID 73349028) has the molecular formula C19H14ClN3O3S and a molecular weight of 399.86 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]spiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,3'-1H-indole]-2',5,7-trione.
| Compound Name | 6-[(4-chlorophenyl)methyl]spiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,3'-1H-indole]-2',5,7-trione |
|---|---|
| PubChem CID | 73349028 |
| Molecular Formula | C19H14ClN3O3S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]spiro[1,7a-dihydroimidazo[1,5-c][1,3]thiazole-3,3'-1H-indole]-2',5,7-trione |
| SMILES | O=C1C2CSC3(C(=O)Nc4ccccc43)N2C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClN3O3S/c20-12-7-5-11(6-8-12)9-22-16(24)15-10-27-19(23(15)18(22)26)13-3-1-2-4-14(13)21-17(19)25/h1-8,15H,9-10H2,(H,21,25) |
| InChIKey | POVQHLNFAUGINO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|