C24H27NO — CID 73349044
(3R)-3,5,11-trimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole (PubChem CID 73349044) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is (3R)-3,5,11-trimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole.
| Compound Name | (3R)-3,5,11-trimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 73349044 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3R)-3,5,11-trimethyl-3-(4-methylpent-3-enyl)pyrano[3,2-a]carbazole |
| SMILES | CC(C)=CCC[C@]1(C)C=Cc2c(c(C)cc3c4ccccc4n(C)c23)O1 |
| InChI | InChI=1S/C24H27NO/c1-16(2)9-8-13-24(4)14-12-19-22-20(15-17(3)23(19)26-24)18-10-6-7-11-21(18)25(22)5/h6-7,9-12,14-15H,8,13H2,1-5H3/t24-/m1/s1 |
| InChIKey | XLSIOCJIGPSWIR-XMMPIXPASA-N |
| XLogP | 6.55 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|