C21H36O3 — CID 73349054
(1R,2R,4S,5E,7S,10Z,14S)-4-methoxy-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-5,10-dien-2-ol (PubChem CID 73349054) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1R,2R,4S,5E,7S,10Z,14S)-4-methoxy-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-5,10-dien-2-ol.
| Compound Name | (1R,2R,4S,5E,7S,10Z,14S)-4-methoxy-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-5,10-dien-2-ol |
|---|---|
| PubChem CID | 73349054 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1R,2R,4S,5E,7S,10Z,14S)-4-methoxy-4,10,14-trimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-5,10-dien-2-ol |
| SMILES | CO[C@]1(C)/C=C/[C@H](C(C)C)CC/C(C)=C\CC[C@]2(C)O[C@@H]2[C@H](O)C1 |
| InChI | InChI=1S/C21H36O3/c1-15(2)17-10-9-16(3)8-7-12-21(5)19(24-21)18(22)14-20(4,23-6)13-11-17/h8,11,13,15,17-19,22H,7,9-10,12,14H2,1-6H3/b13-11+,16-8-/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | TWRIPAVLXRTSCN-HTEFKWDWSA-N |
| XLogP | 4.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|