C15H22O3 — CID 73349164
(4Z,5R,10R)-2,2,10-trimethyl-4-(2-oxopropylidene)-6-oxaspiro[4.5]decan-7-one (PubChem CID 73349164) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4Z,5R,10R)-2,2,10-trimethyl-4-(2-oxopropylidene)-6-oxaspiro[4.5]decan-7-one.
| Compound Name | (4Z,5R,10R)-2,2,10-trimethyl-4-(2-oxopropylidene)-6-oxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 73349164 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4Z,5R,10R)-2,2,10-trimethyl-4-(2-oxopropylidene)-6-oxaspiro[4.5]decan-7-one |
| SMILES | CC(=O)/C=C1/CC(C)(C)C[C@]12OC(=O)CC[C@H]2C |
| InChI | InChI=1S/C15H22O3/c1-10-5-6-13(17)18-15(10)9-14(3,4)8-12(15)7-11(2)16/h7,10H,5-6,8-9H2,1-4H3/b12-7-/t10-,15-/m1/s1 |
| InChIKey | IBQIHYCIZUNKBO-LZAIWYQLSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|