C15H14O4 — CID 73349181
(7R)-7-methyl-2-propan-2-ylidene-6,7-dihydrofuro[3,2-h]isochromene-3,9-dione (PubChem CID 73349181) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (7R)-7-methyl-2-propan-2-ylidene-6,7-dihydrofuro[3,2-h]isochromene-3,9-dione.
| Compound Name | (7R)-7-methyl-2-propan-2-ylidene-6,7-dihydrofuro[3,2-h]isochromene-3,9-dione |
|---|---|
| PubChem CID | 73349181 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (7R)-7-methyl-2-propan-2-ylidene-6,7-dihydrofuro[3,2-h]isochromene-3,9-dione |
| SMILES | CC(C)=C1Oc2c(ccc3c2C(=O)O[C@H](C)C3)C1=O |
| InChI | InChI=1S/C15H14O4/c1-7(2)13-12(16)10-5-4-9-6-8(3)18-15(17)11(9)14(10)19-13/h4-5,8H,6H2,1-3H3/t8-/m1/s1 |
| InChIKey | JEBVCMMFVQCLIM-MRVPVSSYSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|