About 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide
2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide (PubChem CID 73349208) has the molecular formula C16H10Br2N2O3
and a molecular weight of 438.08 g/mol. Its IUPAC name is 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide |
| PubChem CID | 73349208 |
| Molecular Formula | C16H10Br2N2O3 |
| Molecular Weight | 438.08 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2cc(Br)cc(Br)c21)Nc1ccccc1 |
| InChI | InChI=1S/C16H10Br2N2O3/c17-9-6-11-14(12(18)7-9)20(16(23)15(11)22)8-13(21)19-10-4-2-1-3-5-10/h1-7H,8H2,(H,19,21) |
| InChIKey | VNNPNBVSQNSJNK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide?
The IUPAC name of 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide (CID 73349208) is 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide.
What is the SMILES notation for 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide?
The canonical SMILES for 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide is O=C(CN1C(=O)C(=O)c2cc(Br)cc(Br)c21)Nc1ccccc1.
What is the InChIKey of 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide?
The InChIKey is VNNPNBVSQNSJNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2N2O3/c17-9-6-11-14(12(18)7-9)20(16(23)15(11)22)8-13(21)19-10-4-2-1-3-5-10/h1-7H,8H2,(H,19,21).
What are the key properties of 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide?
2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide has a molecular weight of 438.08 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,7-dibromo-2,3-dioxoindol-1-yl)-N-phenylacetamide is sourced from PubChem (CID 73349208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).