C22H17F3O5 — CID 73349375
(1S,8R)-8-methyl-12-phenyl-3-[4-(trifluoromethyl)phenyl]-4,9,10,11-tetraoxatricyclo[6.2.2.01,6]dodec-6-en-5-one (PubChem CID 73349375) has the molecular formula C22H17F3O5 and a molecular weight of 418.37 g/mol. Its IUPAC name is (1S,8R)-8-methyl-12-phenyl-3-[4-(trifluoromethyl)phenyl]-4,9,10,11-tetraoxatricyclo[6.2.2.01,6]dodec-6-en-5-one.
| Compound Name | (1S,8R)-8-methyl-12-phenyl-3-[4-(trifluoromethyl)phenyl]-4,9,10,11-tetraoxatricyclo[6.2.2.01,6]dodec-6-en-5-one |
|---|---|
| PubChem CID | 73349375 |
| Molecular Formula | C22H17F3O5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (1S,8R)-8-methyl-12-phenyl-3-[4-(trifluoromethyl)phenyl]-4,9,10,11-tetraoxatricyclo[6.2.2.01,6]dodec-6-en-5-one |
| SMILES | C[C@]12C=C3C(=O)OC(c4ccc(C(F)(F)F)cc4)C[C@@]3(OO1)OC2c1ccccc1 |
| InChI | InChI=1S/C22H17F3O5/c1-20-11-16-19(26)27-17(13-7-9-15(10-8-13)22(23,24)25)12-21(16,30-29-20)28-18(20)14-5-3-2-4-6-14/h2-11,17-18H,12H2,1H3/t17?,18?,20-,21+/m1/s1 |
| InChIKey | TTWWMNDNYMMOHF-FMFRFZGHSA-N |
| XLogP | 4.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|