C24H28N2O — CID 73349390
trans-(1R,2R)-N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 73349390) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 73349390 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | trans-(1R,2R)-N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@@H]1C[C@H]1c1ccccc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N2O/c1-17(18-12-14-20(15-13-18)19-8-4-2-5-9-19)25-26-24(27)23-16-22(23)21-10-6-3-7-11-21/h3,6-7,10-15,19,22-23H,2,4-5,8-9,16H2,1H3,(H,26,27)/b25-17+/t22-,23+/m0/s1 |
| InChIKey | XDQVGZCHPZGOBG-ZILGIFHJSA-N |
| XLogP | 5.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|