C15H19NOS — CID 73349612
(2E,4E,6E)-N-(2-methylpropyl)-7-thiophen-2-ylhepta-2,4,6-trienamide (PubChem CID 73349612) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (2E,4E,6E)-N-(2-methylpropyl)-7-thiophen-2-ylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E,6E)-N-(2-methylpropyl)-7-thiophen-2-ylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 73349612 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (2E,4E,6E)-N-(2-methylpropyl)-7-thiophen-2-ylhepta-2,4,6-trienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/C=C/c1cccs1 |
| InChI | InChI=1S/C15H19NOS/c1-13(2)12-16-15(17)10-6-4-3-5-8-14-9-7-11-18-14/h3-11,13H,12H2,1-2H3,(H,16,17)/b4-3+,8-5+,10-6+ |
| InChIKey | HGIRIKHYYMPDAG-IZMYCKBJSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|