C23H20FN3O3 — CID 73349675
4-[(3aS,4R,7R,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile (PubChem CID 73349675) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-[(3aS,4R,7R,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile.
| Compound Name | 4-[(3aS,4R,7R,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 73349675 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[(3aS,4R,7R,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2[C@H]3C(=O)N(Cc4ccc(F)cc4)C(=O)[C@H]3[C@@H]3C[C@@H](O)CN32)cc1 |
| InChI | InChI=1S/C23H20FN3O3/c24-16-7-3-14(4-8-16)11-27-22(29)19-18-9-17(28)12-26(18)21(20(19)23(27)30)15-5-1-13(10-25)2-6-15/h1-8,17-21,28H,9,11-12H2/t17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | YLKLDYMLLCFZFB-SYAJIYQZSA-N |
| XLogP | 1.99 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|