C24H22FN3O3 — CID 73349676
4-[(3aS,4R,7S,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-methoxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile (PubChem CID 73349676) has the molecular formula C24H22FN3O3 and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[(3aS,4R,7S,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-methoxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile.
| Compound Name | 4-[(3aS,4R,7S,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-methoxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 73349676 |
| Molecular Formula | C24H22FN3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[(3aS,4R,7S,8aS,8bR)-2-[(4-fluorophenyl)methyl]-7-methoxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
| SMILES | CO[C@H]1C[C@H]2[C@@H]3C(=O)N(Cc4ccc(F)cc4)C(=O)[C@@H]3[C@H](c3ccc(C#N)cc3)N2C1 |
| InChI | InChI=1S/C24H22FN3O3/c1-31-18-10-19-20-21(22(27(19)13-18)16-6-2-14(11-26)3-7-16)24(30)28(23(20)29)12-15-4-8-17(25)9-5-15/h2-9,18-22H,10,12-13H2,1H3/t18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | RBIOJLHJZJIFRI-YFNVTMOMSA-N |
| XLogP | 2.64 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|