C25H32O5 — CID 73349970
2-[2-[(3aS,5R,6R)-5-hydroxy-6-[(E,3R)-3-hydroxy-3-(2-methyl-1,3-dihydroinden-2-yl)prop-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 73349970) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R)-5-hydroxy-6-[(E,3R)-3-hydroxy-3-(2-methyl-1,3-dihydroinden-2-yl)prop-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aS,5R,6R)-5-hydroxy-6-[(E,3R)-3-hydroxy-3-(2-methyl-1,3-dihydroinden-2-yl)prop-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 73349970 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[2-[(3aS,5R,6R)-5-hydroxy-6-[(E,3R)-3-hydroxy-3-(2-methyl-1,3-dihydroinden-2-yl)prop-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | CC1([C@H](O)/C=C/[C@@H]2C3CC(CCOCC(=O)O)=C[C@H]3C[C@H]2O)Cc2ccccc2C1 |
| InChI | InChI=1S/C25H32O5/c1-25(13-17-4-2-3-5-18(17)14-25)23(27)7-6-20-21-11-16(8-9-30-15-24(28)29)10-19(21)12-22(20)26/h2-7,10,19-23,26-27H,8-9,11-15H2,1H3,(H,28,29)/b7-6+/t19-,20+,21?,22+,23+/m0/s1 |
| InChIKey | NQCCDXBXLIDKLL-ISXFZOOKSA-N |
| XLogP | 3.14 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|