C24H30O5 — CID 73349971
2-[2-[(3aS,5R,6R)-6-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid (PubChem CID 73349971) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R)-6-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3aS,5R,6R)-6-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 73349971 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[2-[(3aS,5R,6R)-6-[(E,3S)-3-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyprop-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@@H](O)C3Cc4ccccc4C3)C2C1 |
| InChI | InChI=1S/C24H30O5/c25-22(19-11-16-3-1-2-4-17(16)12-19)6-5-20-21-10-15(7-8-29-14-24(27)28)9-18(21)13-23(20)26/h1-6,9,18-23,25-26H,7-8,10-14H2,(H,27,28)/b6-5+/t18-,20+,21?,22+,23+/m0/s1 |
| InChIKey | YTHJREJUHFWUFT-YZLKAQQJSA-N |
| XLogP | 2.75 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|