C27H27NO7 — CID 73350539
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate (PubChem CID 73350539) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 73350539 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-2-oxooxolan-3-yl]methyl]-2-methoxyphenyl] pyridine-3-carboxylate |
| SMILES | COc1ccc(C[C@H]2COC(=O)[C@@H]2Cc2ccc(OC(=O)c3cccnc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H27NO7/c1-31-22-8-6-17(13-24(22)32-2)11-20-16-34-27(30)21(20)12-18-7-9-23(25(14-18)33-3)35-26(29)19-5-4-10-28-15-19/h4-10,13-15,20-21H,11-12,16H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | RYCPRSWGUVEOAK-LEWJYISDSA-N |
| XLogP | 3.90 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|