C16H13F3N6O2S — CID 73350543
(1S,8R)-10-methyl-14-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,5,10,11,14-pentazatetracyclo[6.5.1.02,6.09,13]tetradeca-2(6),3,9(13),11-tetraene (PubChem CID 73350543) has the molecular formula C16H13F3N6O2S and a molecular weight of 410.38 g/mol. Its IUPAC name is (1S,8R)-10-methyl-14-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,5,10,11,14-pentazatetracyclo[6.5.1.02,6.09,13]tetradeca-2(6),3,9(13),11-tetraene.
| Compound Name | (1S,8R)-10-methyl-14-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,5,10,11,14-pentazatetracyclo[6.5.1.02,6.09,13]tetradeca-2(6),3,9(13),11-tetraene |
|---|---|
| PubChem CID | 73350543 |
| Molecular Formula | C16H13F3N6O2S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (1S,8R)-10-methyl-14-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,5,10,11,14-pentazatetracyclo[6.5.1.02,6.09,13]tetradeca-2(6),3,9(13),11-tetraene |
| SMILES | Cn1ncc2c1[C@H]1Cc3[nH]ncc3[C@@H]2N1S(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H13F3N6O2S/c1-24-15-10(7-22-24)14-9-6-21-23-11(9)4-12(15)25(14)28(26,27)8-2-3-13(20-5-8)16(17,18)19/h2-3,5-7,12,14H,4H2,1H3,(H,21,23)/t12-,14+/m1/s1 |
| InChIKey | QPKPFIMOLTWDPC-OCCSQVGLSA-N |
| XLogP | 1.95 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |