C22H22O8 — CID 73350644
(1R,2S,5S,6R,8S,10S,11S)-8-hydroxy-2,11-dimethyl-12-methylidene-5-phenylmethoxy-3,7,14-trioxatetracyclo[9.3.1.02,6.06,10]pentadecane-4,9,13-trione (PubChem CID 73350644) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is (1R,2S,5S,6R,8S,10S,11S)-8-hydroxy-2,11-dimethyl-12-methylidene-5-phenylmethoxy-3,7,14-trioxatetracyclo[9.3.1.02,6.06,10]pentadecane-4,9,13-trione.
| Compound Name | (1R,2S,5S,6R,8S,10S,11S)-8-hydroxy-2,11-dimethyl-12-methylidene-5-phenylmethoxy-3,7,14-trioxatetracyclo[9.3.1.02,6.06,10]pentadecane-4,9,13-trione |
|---|---|
| PubChem CID | 73350644 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (1R,2S,5S,6R,8S,10S,11S)-8-hydroxy-2,11-dimethyl-12-methylidene-5-phenylmethoxy-3,7,14-trioxatetracyclo[9.3.1.02,6.06,10]pentadecane-4,9,13-trione |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@]1(C)[C@@H]1C(=O)[C@@H](O)O[C@@]13[C@H](OCc1ccccc1)C(=O)O[C@@]23C |
| InChI | InChI=1S/C22H22O8/c1-11-17(24)28-13-9-20(11,2)15-14(23)18(25)30-22(15)16(19(26)29-21(13,22)3)27-10-12-7-5-4-6-8-12/h4-8,13,15-16,18,25H,1,9-10H2,2-3H3/t13-,15+,16-,18+,20-,21+,22-/m1/s1 |
| InChIKey | IOUOVOHYRJFNHE-QMDSWMCQSA-N |
| XLogP | 1.05 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|