C21H22O9 — CID 73350750
(2R)-2-[(2S,3R,4S,5S,6R)-6-(benzoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-phenylacetic acid (PubChem CID 73350750) has the molecular formula C21H22O9 and a molecular weight of 418.40 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,4S,5S,6R)-6-(benzoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-phenylacetic acid.
| Compound Name | (2R)-2-[(2S,3R,4S,5S,6R)-6-(benzoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 73350750 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (2R)-2-[(2S,3R,4S,5S,6R)-6-(benzoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-2-phenylacetic acid |
| SMILES | O=C(OC[C@H]1O[C@@H](O[C@@H](C(=O)O)c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C21H22O9/c22-15-14(11-28-20(27)13-9-5-2-6-10-13)29-21(17(24)16(15)23)30-18(19(25)26)12-7-3-1-4-8-12/h1-10,14-18,21-24H,11H2,(H,25,26)/t14-,15-,16+,17-,18-,21+/m1/s1 |
| InChIKey | WYYUKFFHGFCNBT-MBPYKEKKSA-N |
| XLogP | 0.49 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |