C16H18F2N4O — CID 73350799
(2R,3S,5R)-2-(2,4-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine (PubChem CID 73350799) has the molecular formula C16H18F2N4O and a molecular weight of 320.34 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,4-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,4-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
|---|---|
| PubChem CID | 73350799 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2R,3S,5R)-2-(2,4-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn[nH]c3C2)CO[C@@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C16H18F2N4O/c17-10-1-2-12(13(18)3-10)16-14(19)4-11(8-23-16)22-6-9-5-20-21-15(9)7-22/h1-3,5,11,14,16H,4,6-8,19H2,(H,20,21)/t11-,14+,16-/m1/s1 |
| InChIKey | NLWHSSMEBZJNML-DIOULYMOSA-N |
| XLogP | 1.86 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |