C29H33NO9 — CID 73350828
[(4bS,8aS,9S,10S)-10-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-nitrobenzoate (PubChem CID 73350828) has the molecular formula C29H33NO9 and a molecular weight of 539.58 g/mol. Its IUPAC name is [(4bS,8aS,9S,10S)-10-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-nitrobenzoate.
| Compound Name | [(4bS,8aS,9S,10S)-10-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 73350828 |
| Molecular Formula | C29H33NO9 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [(4bS,8aS,9S,10S)-10-acetyloxy-9-hydroxy-4b,8,8-trimethyl-1,4-dioxo-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-nitrobenzoate |
| SMILES | CC(=O)O[C@H]1C2=C(C(=O)C(OC(=O)c3ccc([N+](=O)[O-])cc3)=C(C(C)C)C2=O)[C@@]2(C)CCCC(C)(C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C29H33NO9/c1-14(2)18-21(32)19-20(22(33)24(18)39-27(35)16-8-10-17(11-9-16)30(36)37)29(6)13-7-12-28(4,5)26(29)23(34)25(19)38-15(3)31/h8-11,14,23,25-26,34H,7,12-13H2,1-6H3/t23-,25+,26+,29-/m1/s1 |
| InChIKey | RFWAWKPCIWWYGD-YQASLYCHSA-N |
| XLogP | 4.25 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|