About ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate
ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate (PubChem CID 73351041) has the molecular formula C14H16N4O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate |
| PubChem CID | 73351041 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N/N=C(\C)c2cccnc2)nc1C |
| InChI | InChI=1S/C14H16N4O2S/c1-4-20-13(19)12-10(3)16-14(21-12)18-17-9(2)11-6-5-7-15-8-11/h5-8H,4H2,1-3H3,(H,16,18)/b17-9+ |
| InChIKey | OEPJZLZXEYSGNE-RQZCQDPDSA-N |
| XLogP | 2.86 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate (CID 73351041) is ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(N/N=C(\C)c2cccnc2)nc1C.
What is the InChIKey of ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate?
The InChIKey is OEPJZLZXEYSGNE-RQZCQDPDSA-N. The full InChI is InChI=1S/C14H16N4O2S/c1-4-20-13(19)12-10(3)16-14(21-12)18-17-9(2)11-6-5-7-15-8-11/h5-8H,4H2,1-3H3,(H,16,18)/b17-9+.
What are the key properties of ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate?
ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate has a molecular weight of 304.38 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-2-[(2E)-2-(1-pyridin-3-ylethylidene)hydrazinyl]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 73351041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).