About ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate
ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 73351098) has the molecular formula C14H15BrO5
and a molecular weight of 343.17 g/mol. Its IUPAC name is ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 73351098 |
| Molecular Formula | C14H15BrO5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(Br)c(OC)cc(OC)c2c1C |
| InChI | InChI=1S/C14H15BrO5/c1-5-19-14(16)12-7(2)10-8(17-3)6-9(18-4)11(15)13(10)20-12/h6H,5H2,1-4H3 |
| InChIKey | BHKWGVZRHLMIPB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate (CID 73351098) is ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate is CCOC(=O)c1oc2c(Br)c(OC)cc(OC)c2c1C.
What is the InChIKey of ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is BHKWGVZRHLMIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrO5/c1-5-19-14(16)12-7(2)10-8(17-3)6-9(18-4)11(15)13(10)20-12/h6H,5H2,1-4H3.
What are the key properties of ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate?
ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 343.17 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-bromo-4,6-dimethoxy-3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 73351098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).