C17H28O5 — CID 73351420
methyl (2R)-2-[(3R,6R)-6-methoxy-6-[(3E,5E)-octa-3,5-dienyl]dioxan-3-yl]propanoate (PubChem CID 73351420) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (2R)-2-[(3R,6R)-6-methoxy-6-[(3E,5E)-octa-3,5-dienyl]dioxan-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(3R,6R)-6-methoxy-6-[(3E,5E)-octa-3,5-dienyl]dioxan-3-yl]propanoate |
|---|---|
| PubChem CID | 73351420 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl (2R)-2-[(3R,6R)-6-methoxy-6-[(3E,5E)-octa-3,5-dienyl]dioxan-3-yl]propanoate |
| SMILES | CC/C=C/C=C/CC[C@]1(OC)CC[C@H]([C@@H](C)C(=O)OC)OO1 |
| InChI | InChI=1S/C17H28O5/c1-5-6-7-8-9-10-12-17(20-4)13-11-15(21-22-17)14(2)16(18)19-3/h6-9,14-15H,5,10-13H2,1-4H3/b7-6+,9-8+/t14-,15-,17-/m1/s1 |
| InChIKey | AVVJENKVGUQZBN-PBDYVILDSA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|