C16H19NO — CID 73351439
(1R,13E)-1-amino-13-ethylidene-11-methyltricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-ol (PubChem CID 73351439) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (1R,13E)-1-amino-13-ethylidene-11-methyltricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-ol.
| Compound Name | (1R,13E)-1-amino-13-ethylidene-11-methyltricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-ol |
|---|---|
| PubChem CID | 73351439 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1R,13E)-1-amino-13-ethylidene-11-methyltricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraen-5-ol |
| SMILES | C/C=C1\C2C=C(C)C[C@]1(N)c1ccc(O)cc1C2 |
| InChI | InChI=1S/C16H19NO/c1-3-14-11-6-10(2)9-16(14,17)15-5-4-13(18)8-12(15)7-11/h3-6,8,11,18H,7,9,17H2,1-2H3/b14-3+/t11?,16-/m1/s1 |
| InChIKey | XRMHFNQZCJKNPO-VKSOVZOBSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|