C15H15F3N2O3S — CID 73351903
[2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indol-5-yl] trifluoromethanesulfonate (PubChem CID 73351903) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is [2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indol-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 73351903 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-methyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indol-5-yl] trifluoromethanesulfonate |
| SMILES | Cc1[nH]c2ccc(OS(=O)(=O)C(F)(F)F)cc2c1C1=CCNCC1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-9-14(10-4-6-19-7-5-10)12-8-11(2-3-13(12)20-9)23-24(21,22)15(16,17)18/h2-4,8,19-20H,5-7H2,1H3 |
| InChIKey | TVGSRQITRNMKJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|