About 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole
2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole (PubChem CID 73351958) has the molecular formula C20H18ClN3
and a molecular weight of 335.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole |
| PubChem CID | 73351958 |
| Molecular Formula | C20H18ClN3 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole |
| SMILES | Cc1ccc2[nH]c(-c3ccc(Cl)cc3)c(-n3nc(C)cc3C)c2c1 |
| InChI | InChI=1S/C20H18ClN3/c1-12-4-9-18-17(10-12)20(24-14(3)11-13(2)23-24)19(22-18)15-5-7-16(21)8-6-15/h4-11,22H,1-3H3 |
| InChIKey | GPBFYDZOXJGTPC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole?
The IUPAC name of 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole (CID 73351958) is 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole.
What is the SMILES notation for 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole?
The canonical SMILES for 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole is Cc1ccc2[nH]c(-c3ccc(Cl)cc3)c(-n3nc(C)cc3C)c2c1.
What is the InChIKey of 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole?
The InChIKey is GPBFYDZOXJGTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3/c1-12-4-9-18-17(10-12)20(24-14(3)11-13(2)23-24)19(22-18)15-5-7-16(21)8-6-15/h4-11,22H,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole?
2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole has a molecular weight of 335.84 g/mol, XLogP of 5.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1H-indole is sourced from PubChem (CID 73351958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).