C36H44N4O2 — CID 73352067
(1R,2R,4R,5Z,12R,13S,15E,17R)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,15,25-triene-13,17-diol (PubChem CID 73352067) has the molecular formula C36H44N4O2 and a molecular weight of 564.77 g/mol. Its IUPAC name is (1R,2R,4R,5Z,12R,13S,15E,17R)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,15,25-triene-13,17-diol.
| Compound Name | (1R,2R,4R,5Z,12R,13S,15E,17R)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,15,25-triene-13,17-diol |
|---|---|
| PubChem CID | 73352067 |
| Molecular Formula | C36H44N4O2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | (1R,2R,4R,5Z,12R,13S,15E,17R)-25-(9H-pyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,15,25-triene-13,17-diol |
| SMILES | O[C@H]1/C=C\C[C@]2(O)C=C(c3nccc4c3[nH]c3ccccc34)[C@@H]3CCN(CCCC1)C[C@@]31C[C@@H]3/C=C\CCCCN3[C@H]12 |
| InChI | InChI=1S/C36H44N4O2/c41-26-11-6-8-19-39-21-16-30-29(32-33-28(15-18-37-32)27-13-4-5-14-31(27)38-33)23-36(42,17-9-12-26)34-35(30,24-39)22-25-10-3-1-2-7-20-40(25)34/h3-5,9-10,12-15,18,23,25-26,30,34,38,41-42H,1-2,6-8,11,16-17,19-22,24H2/b10-3-,12-9-/t25-,26+,30-,34+,35-,36-/m0/s1 |
| InChIKey | MEENDJHJWGTWGE-DZTXGRHRSA-N |
| XLogP | 5.83 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|