C8H8O5S — CID 73352124
2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiine-4,7-diol (PubChem CID 73352124) has the molecular formula C8H8O5S and a molecular weight of 216.21 g/mol. Its IUPAC name is 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiine-4,7-diol.
| Compound Name | 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiine-4,7-diol |
|---|---|
| PubChem CID | 73352124 |
| Molecular Formula | C8H8O5S |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiine-4,7-diol |
| SMILES | O=S1(=O)CC(O)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C8H8O5S/c9-5-1-2-6-7(10)4-14(11,12)13-8(6)3-5/h1-3,7,9-10H,4H2 |
| InChIKey | XHZPEFRRQPBHBC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|