C17H18O9 — CID 73352140
[(1S,3R,6S,9R,10S,13S,14R,15S)-10,15-dimethyl-2,7,12-trioxo-4,8,11,17-tetraoxapentacyclo[7.5.2.13,14.06,15.010,14]heptadecan-13-yl] acetate (PubChem CID 73352140) has the molecular formula C17H18O9 and a molecular weight of 366.32 g/mol. Its IUPAC name is [(1S,3R,6S,9R,10S,13S,14R,15S)-10,15-dimethyl-2,7,12-trioxo-4,8,11,17-tetraoxapentacyclo[7.5.2.13,14.06,15.010,14]heptadecan-13-yl] acetate.
| Compound Name | [(1S,3R,6S,9R,10S,13S,14R,15S)-10,15-dimethyl-2,7,12-trioxo-4,8,11,17-tetraoxapentacyclo[7.5.2.13,14.06,15.010,14]heptadecan-13-yl] acetate |
|---|---|
| PubChem CID | 73352140 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(1S,3R,6S,9R,10S,13S,14R,15S)-10,15-dimethyl-2,7,12-trioxo-4,8,11,17-tetraoxapentacyclo[7.5.2.13,14.06,15.010,14]heptadecan-13-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)O[C@@]2(C)[C@H]3C[C@]4(C)[C@@H](CO[C@@H]5O[C@]12[C@H]4C5=O)C(=O)O3 |
| InChI | InChI=1S/C17H18O9/c1-6(18)23-11-13(21)25-16(3)8-4-15(2)7(12(20)24-8)5-22-14-9(19)10(15)17(11,16)26-14/h7-8,10-11,14H,4-5H2,1-3H3/t7-,8+,10-,11+,14+,15+,16-,17+/m0/s1 |
| InChIKey | DDCKNZQHWXBHMN-RPZAFYRJSA-N |
| XLogP | -0.50 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|