C31H35N7 — CID 73352249
2,6-bis[(1-benzylpiperidin-4-yl)amino]pyridine-3,5-dicarbonitrile (PubChem CID 73352249) has the molecular formula C31H35N7 and a molecular weight of 505.67 g/mol. Its IUPAC name is 2,6-bis[(1-benzylpiperidin-4-yl)amino]pyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-bis[(1-benzylpiperidin-4-yl)amino]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 73352249 |
| Molecular Formula | C31H35N7 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2,6-bis[(1-benzylpiperidin-4-yl)amino]pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(NC2CCN(Cc3ccccc3)CC2)nc1NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H35N7/c32-20-26-19-27(21-33)31(35-29-13-17-38(18-14-29)23-25-9-5-2-6-10-25)36-30(26)34-28-11-15-37(16-12-28)22-24-7-3-1-4-8-24/h1-10,19,28-29H,11-18,22-23H2,(H2,34,35,36) |
| InChIKey | OXQRMHHRDWXOPE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |