C20H12Cl5NO3S — CID 73352276
2-morpholin-4-yl-3-(2,3,4,5,6-pentachlorophenyl)sulfanylnaphthalene-1,4-dione (PubChem CID 73352276) has the molecular formula C20H12Cl5NO3S and a molecular weight of 523.65 g/mol. Its IUPAC name is 2-morpholin-4-yl-3-(2,3,4,5,6-pentachlorophenyl)sulfanylnaphthalene-1,4-dione.
| Compound Name | 2-morpholin-4-yl-3-(2,3,4,5,6-pentachlorophenyl)sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 73352276 |
| Molecular Formula | C20H12Cl5NO3S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 520.90 |
| IUPAC Name | 2-morpholin-4-yl-3-(2,3,4,5,6-pentachlorophenyl)sulfanylnaphthalene-1,4-dione |
| SMILES | O=C1C(Sc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)=C(N2CCOCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H12Cl5NO3S/c21-11-12(22)14(24)19(15(25)13(11)23)30-20-16(26-5-7-29-8-6-26)17(27)9-3-1-2-4-10(9)18(20)28/h1-4H,5-8H2 |
| InChIKey | IKQMBMNDCJRBDI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|