About methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate (PubChem CID 73352462) has the molecular formula C23H17F7N2O2
and a molecular weight of 486.39 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate |
| PubChem CID | 73352462 |
| Molecular Formula | C23H17F7N2O2 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate |
| SMILES | COC(=O)C(NCc1cnccc1-c1ccccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F7N2O2/c1-34-21(33)20(13-8-15(22(25,26)27)10-16(9-13)23(28,29)30)32-12-14-11-31-7-6-17(14)18-4-2-3-5-19(18)24/h2-11,20,32H,12H2,1H3 |
| InChIKey | GEMHCOAHIKZOMD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate?
The IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate (CID 73352462) is methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate.
What is the SMILES notation for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate?
The canonical SMILES for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate is COC(=O)C(NCc1cnccc1-c1ccccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate?
The InChIKey is GEMHCOAHIKZOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F7N2O2/c1-34-21(33)20(13-8-15(22(25,26)27)10-16(9-13)23(28,29)30)32-12-14-11-31-7-6-17(14)18-4-2-3-5-19(18)24/h2-11,20,32H,12H2,1H3.
What are the key properties of methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate?
methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate has a molecular weight of 486.39 g/mol, XLogP of 5.93, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-bis(trifluoromethyl)phenyl]-2-[[4-(2-fluorophenyl)-3-pyridinyl]methylamino]acetate is sourced from PubChem (CID 73352462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).