C16H20N4OS — CID 73352577
2-(2-imino-4-phenyl-1,3-thiazol-3-yl)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 73352577) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-(2-imino-4-phenyl-1,3-thiazol-3-yl)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-imino-4-phenyl-1,3-thiazol-3-yl)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 73352577 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(2-imino-4-phenyl-1,3-thiazol-3-yl)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | [H]/N=c1\scc(-c2ccccc2)n1CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H20N4OS/c1-18-7-9-19(10-8-18)15(21)11-20-14(12-22-16(20)17)13-5-3-2-4-6-13/h2-6,12,17H,7-11H2,1H3/b17-16- |
| InChIKey | XYYGTTPKVXBPPI-MSUUIHNZSA-N |
| XLogP | 1.47 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|