About (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid
(E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid (PubChem CID 73352631) has the molecular formula C17H12FNO5
and a molecular weight of 329.28 g/mol. Its IUPAC name is (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid.
Molecular Properties
| Compound Name | (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid |
| PubChem CID | 73352631 |
| Molecular Formula | C17H12FNO5 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid |
| SMILES | O=C(/C=C/c1cc(C(=O)c2cccc(F)c2)c[nH]1)CC(=O)C(=O)O |
| InChI | InChI=1S/C17H12FNO5/c18-12-3-1-2-10(6-12)16(22)11-7-13(19-9-11)4-5-14(20)8-15(21)17(23)24/h1-7,9,19H,8H2,(H,23,24)/b5-4+ |
| InChIKey | BSZJLJRYNPZJPB-SNAWJCMRSA-N |
| XLogP | 2.01 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid?
The IUPAC name of (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid (CID 73352631) is (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid.
What is the SMILES notation for (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid?
The canonical SMILES for (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid is O=C(/C=C/c1cc(C(=O)c2cccc(F)c2)c[nH]1)CC(=O)C(=O)O.
What is the InChIKey of (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid?
The InChIKey is BSZJLJRYNPZJPB-SNAWJCMRSA-N. The full InChI is InChI=1S/C17H12FNO5/c18-12-3-1-2-10(6-12)16(22)11-7-13(19-9-11)4-5-14(20)8-15(21)17(23)24/h1-7,9,19H,8H2,(H,23,24)/b5-4+.
What are the key properties of (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid?
(E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid has a molecular weight of 329.28 g/mol, XLogP of 2.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-[4-(3-fluorobenzoyl)-1H-pyrrol-2-yl]-2,4-dioxohex-5-enoic acid is sourced from PubChem (CID 73352631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).