C35H27NO13S3 — CID 73352648
23-(4-cyanophenyl)-25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid (PubChem CID 73352648) has the molecular formula C35H27NO13S3 and a molecular weight of 765.80 g/mol. Its IUPAC name is 23-(4-cyanophenyl)-25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid.
| Compound Name | 23-(4-cyanophenyl)-25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
|---|---|
| PubChem CID | 73352648 |
| Molecular Formula | C35H27NO13S3 |
| Molecular Weight | 765.80 g/mol |
| Exact Mass | 765.06 |
| IUPAC Name | 23-(4-cyanophenyl)-25,26,27,28-tetrahydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
| SMILES | N#Cc1ccc(-c2cc3c(O)c(c2)Cc2cc(S(=O)(=O)O)cc(c2O)Cc2cc(S(=O)(=O)O)cc(c2O)Cc2cc(S(=O)(=O)O)cc(c2O)C3)cc1 |
| InChI | InChI=1S/C35H27NO13S3/c36-17-18-1-3-19(4-2-18)20-5-21-7-23-11-29(50(41,42)43)13-25(33(23)38)9-27-15-31(52(47,48)49)16-28(35(27)40)10-26-14-30(51(44,45)46)12-24(34(26)39)8-22(6-20)32(21)37/h1-6,11-16,37-40H,7-10H2,(H,41,42,43)(H,44,45,46)(H,47,48,49) |
| InChIKey | IYNWNVBNEOSFKJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 267.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|