C6H11FO5 — CID 73352744
(1S,2S,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol (PubChem CID 73352744) has the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. Its IUPAC name is (1S,2S,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 73352744 |
| Molecular Formula | C6H11FO5 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1S,2S,4S,5S)-6-fluorocyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@H](O)[C@H](O)C(F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11FO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6,8-12H/t1?,2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | PDTJJYSBSOKEOY-LMEIFLMCSA-N |
| XLogP | -2.86 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |