C22H26N4O4 — CID 73352752
(3S)-2-[(2S)-2-(diaminomethylideneamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 73352752) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-(diaminomethylideneamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2-(diaminomethylideneamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 73352752 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3S)-2-[(2S)-2-(diaminomethylideneamino)-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](N=C(N)N)C(=O)N1Cc2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H26N4O4/c1-12-7-16(27)8-13(2)17(12)10-18(25-22(23)24)20(28)26-11-15-6-4-3-5-14(15)9-19(26)21(29)30/h3-8,18-19,27H,9-11H2,1-2H3,(H,29,30)(H4,23,24,25)/t18-,19-/m0/s1 |
| InChIKey | UPXNEROFENYEAW-OALUTQOASA-N |
| XLogP | 1.23 |
| TPSA | 142.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|