C18H33O8P — CID 73352782
diethyl 2-[(1R,2S,6R,9S,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-2-yl]ethyl phosphate (PubChem CID 73352782) has the molecular formula C18H33O8P and a molecular weight of 408.43 g/mol. Its IUPAC name is diethyl 2-[(1R,2S,6R,9S,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-2-yl]ethyl phosphate.
| Compound Name | diethyl 2-[(1R,2S,6R,9S,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-2-yl]ethyl phosphate |
|---|---|
| PubChem CID | 73352782 |
| Molecular Formula | C18H33O8P |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | diethyl 2-[(1R,2S,6R,9S,12S)-12-methoxy-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecan-2-yl]ethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC[C@@H]1CCC[C@@H]2CC[C@]3(C)OO[C@]21[C@@H](OC)O3 |
| InChI | InChI=1S/C18H33O8P/c1-5-21-27(19,22-6-2)23-13-11-15-9-7-8-14-10-12-17(3)24-16(20-4)18(14,15)26-25-17/h14-16H,5-13H2,1-4H3/t14-,15+,16+,17+,18-/m1/s1 |
| InChIKey | KLPBTXNWFSQLPT-RSJGLCBASA-N |
| XLogP | 4.19 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|