About N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine
N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine (PubChem CID 73352817) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine |
| PubChem CID | 73352817 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine |
| SMILES | C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(C=NO)cn2C |
| InChI | InChI=1S/C21H22N2O4/c1-13(15-9-19(25-3)21(27-5)20(10-15)26-4)14-6-7-18-17(8-14)16(11-22-24)12-23(18)2/h6-12,24H,1H2,2-5H3 |
| InChIKey | DXTUCLSOVKMGAR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine?
The IUPAC name of N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine (CID 73352817) is N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine.
What is the SMILES notation for N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine?
The canonical SMILES for N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine is C=C(c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c(C=NO)cn2C.
What is the InChIKey of N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine?
The InChIKey is DXTUCLSOVKMGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-13(15-9-19(25-3)21(27-5)20(10-15)26-4)14-6-7-18-17(8-14)16(11-22-24)12-23(18)2/h6-12,24H,1H2,2-5H3.
What are the key properties of N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine?
N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine has a molecular weight of 366.42 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-methyl-5-[1-(3,4,5-trimethoxyphenyl)ethenyl]indol-3-yl]methylidene]hydroxylamine is sourced from PubChem (CID 73352817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).