C23H32N2O3 — CID 73352827
benzyl (3aS,6R,6aR)-4-hexyl-5-oxo-6-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 73352827) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is benzyl (3aS,6R,6aR)-4-hexyl-5-oxo-6-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | benzyl (3aS,6R,6aR)-4-hexyl-5-oxo-6-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 73352827 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | benzyl (3aS,6R,6aR)-4-hexyl-5-oxo-6-prop-2-enyl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | C=CC[C@H]1C(=O)N(CCCCCC)[C@H]2CCN(C(=O)OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C23H32N2O3/c1-3-5-6-10-15-24-20-14-16-25(21(20)19(11-4-2)22(24)26)23(27)28-17-18-12-8-7-9-13-18/h4,7-9,12-13,19-21H,2-3,5-6,10-11,14-17H2,1H3/t19-,20+,21-/m1/s1 |
| InChIKey | WQIKUCFGGDPBEB-QHAWAJNXSA-N |
| XLogP | 4.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|