About Ac-Val-Pro-Val-CF3
Ac-Val-Pro-Val-CF3 (PubChem CID 73353306) has the molecular formula C18H28F3N3O4
and a molecular weight of 407.40 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | Ac-Val-Pro-Val-CF3 |
| PubChem CID | 73353306 |
| Molecular Formula | C18H28F3N3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@@H](C(=O)C(F)(F)F)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)C |
| InChI | InChI=1S/C18H28F3N3O4/c1-9(2)13(15(26)18(19,20)21)23-16(27)12-7-6-8-24(12)17(28)14(10(3)4)22-11(5)25/h9-10,12-14H,6-8H2,1-5H3,(H,22,25)(H,23,27)/t12-,13-,14-/m0/s1 |
| InChIKey | FMOWSEKFCPOFEZ-IHRRRGAJSA-N |
| XLogP | 2.10 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | 620 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Ac-Val-Pro-Val-CF3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ac-Val-Pro-Val-CF3?
The IUPAC name of Ac-Val-Pro-Val-CF3 (CID 73353306) is (2S)-1-[(2S)-2-acetamido-3-methylbutanoyl]-N-[(3S)-1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl]pyrrolidine-2-carboxamide.
What is the SMILES notation for Ac-Val-Pro-Val-CF3?
The canonical SMILES for Ac-Val-Pro-Val-CF3 is CC(C)[C@@H](C(=O)C(F)(F)F)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C(C)C)NC(=O)C.
What is the InChIKey of Ac-Val-Pro-Val-CF3?
The InChIKey is FMOWSEKFCPOFEZ-IHRRRGAJSA-N. The full InChI is InChI=1S/C18H28F3N3O4/c1-9(2)13(15(26)18(19,20)21)23-16(27)12-7-6-8-24(12)17(28)14(10(3)4)22-11(5)25/h9-10,12-14H,6-8H2,1-5H3,(H,22,25)(H,23,27)/t12-,13-,14-/m0/s1.
What are the key properties of Ac-Val-Pro-Val-CF3?
Ac-Val-Pro-Val-CF3 has a molecular weight of 407.40 g/mol, XLogP of 2.10, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Ac-Val-Pro-Val-CF3 is sourced from PubChem (CID 73353306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).