C33H48N2O5S — CID 73353350
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[(2-aminobenzoyl)amino]-2-methylpropan-2-yl]sulfanylacetate (PubChem CID 73353350) has the molecular formula C33H48N2O5S and a molecular weight of 584.82 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[(2-aminobenzoyl)amino]-2-methylpropan-2-yl]sulfanylacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[(2-aminobenzoyl)amino]-2-methylpropan-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 73353350 |
| Molecular Formula | C33H48N2O5S |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[(2-aminobenzoyl)amino]-2-methylpropan-2-yl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC(C)(C)CNC(=O)c2ccccc2N)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C33H48N2O5S/c1-8-31(6)17-25(32(7)20(2)13-15-33(21(3)28(31)38)16-14-24(36)27(32)33)40-26(37)18-41-30(4,5)19-35-29(39)22-11-9-10-12-23(22)34/h8-12,20-21,25,27-28,38H,1,13-19,34H2,2-7H3,(H,35,39)/t20-,21+,25-,27+,28+,31-,32+,33+/m1/s1 |
| InChIKey | JVMDBHKMVUJRBC-TYFVDVEPSA-N |
| XLogP | 5.42 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|